C15H23N5O — CID 66740470
4-[(4aR,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-6-cyclopentylpyrimidin-2-amine (PubChem CID 66740470) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-[(4aR,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-6-cyclopentylpyrimidin-2-amine.
| Compound Name | 4-[(4aR,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-6-cyclopentylpyrimidin-2-amine |
|---|---|
| PubChem CID | 66740470 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 4-[(4aR,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-6-cyclopentylpyrimidin-2-amine |
| SMILES | Nc1nc(C2CCCC2)cc(N2C[C@H]3NCCO[C@@H]3C2)n1 |
| InChI | InChI=1S/C15H23N5O/c16-15-18-11(10-3-1-2-4-10)7-14(19-15)20-8-12-13(9-20)21-6-5-17-12/h7,10,12-13,17H,1-6,8-9H2,(H2,16,18,19)/t12-,13-/m1/s1 |
| InChIKey | MAKOJAOOBNXDOF-CHWSQXEVSA-N |
| XLogP | 0.89 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |