C12H10N4O4 — CID 66744572
1-[(2-hydroxyphenyl)methyl]-7,9-dihydro-3H-purine-2,6,8-trione (PubChem CID 66744572) has the molecular formula C12H10N4O4 and a molecular weight of 274.24 g/mol. Its IUPAC name is 1-[(2-hydroxyphenyl)methyl]-7,9-dihydro-3H-purine-2,6,8-trione.
| Compound Name | 1-[(2-hydroxyphenyl)methyl]-7,9-dihydro-3H-purine-2,6,8-trione |
|---|---|
| PubChem CID | 66744572 |
| Molecular Formula | C12H10N4O4 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 1-[(2-hydroxyphenyl)methyl]-7,9-dihydro-3H-purine-2,6,8-trione |
| SMILES | O=c1[nH]c2[nH]c(=O)n(Cc3ccccc3O)c(=O)c2[nH]1 |
| InChI | InChI=1S/C12H10N4O4/c17-7-4-2-1-3-6(7)5-16-10(18)8-9(15-12(16)20)14-11(19)13-8/h1-4,17H,5H2,(H,15,20)(H2,13,14,19) |
| InChIKey | UBJUEIQHMBAFLJ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|