C18H19N7O3S2 — CID 66744771
3-amino-N-pyridin-2-yl-6-(4-thiophen-3-ylsulfonylpiperazin-1-yl)pyrazine-2-carboxamide (PubChem CID 66744771) has the molecular formula C18H19N7O3S2 and a molecular weight of 445.53 g/mol. Its IUPAC name is 3-amino-N-pyridin-2-yl-6-(4-thiophen-3-ylsulfonylpiperazin-1-yl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-pyridin-2-yl-6-(4-thiophen-3-ylsulfonylpiperazin-1-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 66744771 |
| Molecular Formula | C18H19N7O3S2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 3-amino-N-pyridin-2-yl-6-(4-thiophen-3-ylsulfonylpiperazin-1-yl)pyrazine-2-carboxamide |
| SMILES | Nc1ncc(N2CCN(S(=O)(=O)c3ccsc3)CC2)nc1C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C18H19N7O3S2/c19-17-16(18(26)22-14-3-1-2-5-20-14)23-15(11-21-17)24-6-8-25(9-7-24)30(27,28)13-4-10-29-12-13/h1-5,10-12H,6-9H2,(H2,19,21)(H,20,22,26) |
| InChIKey | NKGBFYKHQSXENF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |