C16H18N6O2 — CID 123957243
6-(4-acetylpiperazin-1-yl)-N-pyridin-2-ylpyrazine-2-carboxamide (PubChem CID 123957243) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 6-(4-acetylpiperazin-1-yl)-N-pyridin-2-ylpyrazine-2-carboxamide.
| Compound Name | 6-(4-acetylpiperazin-1-yl)-N-pyridin-2-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123957243 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 6-(4-acetylpiperazin-1-yl)-N-pyridin-2-ylpyrazine-2-carboxamide |
| SMILES | CC(=O)N1CCN(c2cncc(C(=O)Nc3ccccn3)n2)CC1 |
| InChI | InChI=1S/C16H18N6O2/c1-12(23)21-6-8-22(9-7-21)15-11-17-10-13(19-15)16(24)20-14-4-2-3-5-18-14/h2-5,10-11H,6-9H2,1H3,(H,18,20,24) |
| InChIKey | DOTPLRPGMFDECK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |