C17H20N6O3 — CID 123151120
6-[4-(2-methoxyacetyl)piperazin-1-yl]-N-pyridin-2-ylpyrazine-2-carboxamide (PubChem CID 123151120) has the molecular formula C17H20N6O3 and a molecular weight of 356.39 g/mol. Its IUPAC name is 6-[4-(2-methoxyacetyl)piperazin-1-yl]-N-pyridin-2-ylpyrazine-2-carboxamide.
| Compound Name | 6-[4-(2-methoxyacetyl)piperazin-1-yl]-N-pyridin-2-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123151120 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 6-[4-(2-methoxyacetyl)piperazin-1-yl]-N-pyridin-2-ylpyrazine-2-carboxamide |
| SMILES | COCC(=O)N1CCN(c2cncc(C(=O)Nc3ccccn3)n2)CC1 |
| InChI | InChI=1S/C17H20N6O3/c1-26-12-16(24)23-8-6-22(7-9-23)15-11-18-10-13(20-15)17(25)21-14-4-2-3-5-19-14/h2-5,10-11H,6-9,12H2,1H3,(H,19,21,25) |
| InChIKey | QSCZBDNXQYZFKU-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |