About 2-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,7-difluoroquinazoline
2-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,7-difluoroquinazoline (PubChem CID 66745147) has the molecular formula C22H23F2N3O
and a molecular weight of 383.44 g/mol. Its IUPAC name is 2-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,7-difluoroquinazoline.
Molecular Properties
| Compound Name | 2-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,7-difluoroquinazoline |
| PubChem CID | 66745147 |
| Molecular Formula | C22H23F2N3O |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,7-difluoroquinazoline |
| SMILES | Cc1cc(-c2ncc3c(F)cc(F)cc3n2)cc(C)c1OCCN1CCCC1 |
| InChI | InChI=1S/C22H23F2N3O/c1-14-9-16(10-15(2)21(14)28-8-7-27-5-3-4-6-27)22-25-13-18-19(24)11-17(23)12-20(18)26-22/h9-13H,3-8H2,1-2H3 |
| InChIKey | ZNEKNZLOEYKQJJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,7-difluoroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,7-difluoroquinazoline?
The IUPAC name of 2-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,7-difluoroquinazoline (CID 66745147) is 2-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,7-difluoroquinazoline.
What is the SMILES notation for 2-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,7-difluoroquinazoline?
The canonical SMILES for 2-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,7-difluoroquinazoline is Cc1cc(-c2ncc3c(F)cc(F)cc3n2)cc(C)c1OCCN1CCCC1.
What is the InChIKey of 2-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,7-difluoroquinazoline?
The InChIKey is ZNEKNZLOEYKQJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23F2N3O/c1-14-9-16(10-15(2)21(14)28-8-7-27-5-3-4-6-27)22-25-13-18-19(24)11-17(23)12-20(18)26-22/h9-13H,3-8H2,1-2H3.
What are the key properties of 2-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,7-difluoroquinazoline?
2-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,7-difluoroquinazoline has a molecular weight of 383.44 g/mol, XLogP of 4.67, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,7-difluoroquinazoline is sourced from PubChem (CID 66745147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).