About 3-methoxy-2-methyl-2,3-diphenylpropanamide
3-methoxy-2-methyl-2,3-diphenylpropanamide (PubChem CID 66745873) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-methoxy-2-methyl-2,3-diphenylpropanamide.
Molecular Properties
| Compound Name | 3-methoxy-2-methyl-2,3-diphenylpropanamide |
| PubChem CID | 66745873 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-methoxy-2-methyl-2,3-diphenylpropanamide |
| SMILES | COC(c1ccccc1)C(C)(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C17H19NO2/c1-17(16(18)19,14-11-7-4-8-12-14)15(20-2)13-9-5-3-6-10-13/h3-12,15H,1-2H3,(H2,18,19) |
| InChIKey | JVABFJJHSCGGSD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-2-methyl-2,3-diphenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2-methyl-2,3-diphenylpropanamide?
The IUPAC name of 3-methoxy-2-methyl-2,3-diphenylpropanamide (CID 66745873) is 3-methoxy-2-methyl-2,3-diphenylpropanamide.
What is the SMILES notation for 3-methoxy-2-methyl-2,3-diphenylpropanamide?
The canonical SMILES for 3-methoxy-2-methyl-2,3-diphenylpropanamide is COC(c1ccccc1)C(C)(C(N)=O)c1ccccc1.
What is the InChIKey of 3-methoxy-2-methyl-2,3-diphenylpropanamide?
The InChIKey is JVABFJJHSCGGSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-17(16(18)19,14-11-7-4-8-12-14)15(20-2)13-9-5-3-6-10-13/h3-12,15H,1-2H3,(H2,18,19).
What are the key properties of 3-methoxy-2-methyl-2,3-diphenylpropanamide?
3-methoxy-2-methyl-2,3-diphenylpropanamide has a molecular weight of 269.34 g/mol, XLogP of 2.82, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2-methyl-2,3-diphenylpropanamide is sourced from PubChem (CID 66745873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).