C10H14IN5S — CID 66748068
5-iodo-N-methyl-N-piperidin-4-ylimidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 66748068) has the molecular formula C10H14IN5S and a molecular weight of 363.23 g/mol. Its IUPAC name is 5-iodo-N-methyl-N-piperidin-4-ylimidazo[2,1-b][1,3,4]thiadiazol-2-amine.
| Compound Name | 5-iodo-N-methyl-N-piperidin-4-ylimidazo[2,1-b][1,3,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 66748068 |
| Molecular Formula | C10H14IN5S |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 5-iodo-N-methyl-N-piperidin-4-ylimidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| SMILES | CN(c1nn2c(I)cnc2s1)C1CCNCC1 |
| InChI | InChI=1S/C10H14IN5S/c1-15(7-2-4-12-5-3-7)10-14-16-8(11)6-13-9(16)17-10/h6-7,12H,2-5H2,1H3 |
| InChIKey | OIBVPKZILGPUAE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|