C24H25N5O — CID 66749329
N-(cyclohexylmethyl)-7-phenoxy-2-pyrazol-1-ylquinazolin-4-amine (PubChem CID 66749329) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-7-phenoxy-2-pyrazol-1-ylquinazolin-4-amine.
| Compound Name | N-(cyclohexylmethyl)-7-phenoxy-2-pyrazol-1-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 66749329 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N-(cyclohexylmethyl)-7-phenoxy-2-pyrazol-1-ylquinazolin-4-amine |
| SMILES | c1ccc(Oc2ccc3c(NCC4CCCCC4)nc(-n4cccn4)nc3c2)cc1 |
| InChI | InChI=1S/C24H25N5O/c1-3-8-18(9-4-1)17-25-23-21-13-12-20(30-19-10-5-2-6-11-19)16-22(21)27-24(28-23)29-15-7-14-26-29/h2,5-7,10-16,18H,1,3-4,8-9,17H2,(H,25,27,28) |
| InChIKey | MSFUKWUDQCHHGR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |