C37H43N3O6 — CID 6675015
N'-hydroxy-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1R)-1-naphthalen-2-ylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]pentanediamide (PubChem CID 6675015) has the molecular formula C37H43N3O6 and a molecular weight of 625.77 g/mol. Its IUPAC name is N'-hydroxy-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1R)-1-naphthalen-2-ylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]pentanediamide.
| Compound Name | N'-hydroxy-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1R)-1-naphthalen-2-ylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]pentanediamide |
|---|---|
| PubChem CID | 6675015 |
| Molecular Formula | C37H43N3O6 |
| Molecular Weight | 625.77 g/mol |
| Exact Mass | 625.32 |
| IUPAC Name | N'-hydroxy-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1R)-1-naphthalen-2-ylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]pentanediamide |
| SMILES | C[C@H](c1ccc2ccccc2c1)N(C)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(CNC(=O)CCCC(=O)NO)cc2)O1 |
| InChI | InChI=1S/C37H43N3O6/c1-25(31-19-18-28-6-3-4-7-32(28)20-31)40(2)23-33-21-34(29-14-12-27(24-41)13-15-29)46-37(45-33)30-16-10-26(11-17-30)22-38-35(42)8-5-9-36(43)39-44/h3-4,6-7,10-20,25,33-34,37,41,44H,5,8-9,21-24H2,1-2H3,(H,38,42)(H,39,43)/t25-,33-,34+,37+/m1/s1 |
| InChIKey | NSDDKEFLFNJHDZ-ZPYQNIJUSA-N |
| XLogP | 5.86 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.77 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|