C29H32N2O6S — CID 66750786
2-[(2,4-dimethoxyphenyl)methyl]-5-(2,2-dimethyl-6-phenylmethoxy-1,3-dihydroinden-5-yl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 66750786) has the molecular formula C29H32N2O6S and a molecular weight of 536.65 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methyl]-5-(2,2-dimethyl-6-phenylmethoxy-1,3-dihydroinden-5-yl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 2-[(2,4-dimethoxyphenyl)methyl]-5-(2,2-dimethyl-6-phenylmethoxy-1,3-dihydroinden-5-yl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 66750786 |
| Molecular Formula | C29H32N2O6S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)methyl]-5-(2,2-dimethyl-6-phenylmethoxy-1,3-dihydroinden-5-yl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | COc1ccc(CN2C(=O)CN(c3cc4c(cc3OCc3ccccc3)CC(C)(C)C4)S2(=O)=O)c(OC)c1 |
| InChI | InChI=1S/C29H32N2O6S/c1-29(2)15-22-12-25(27(13-23(22)16-29)37-19-20-8-6-5-7-9-20)30-18-28(32)31(38(30,33)34)17-21-10-11-24(35-3)14-26(21)36-4/h5-14H,15-19H2,1-4H3 |
| InChIKey | GPOJLFQBSIUCGY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |