C20H25IN2O4SSi — CID 66756937
5-(4-iodo-2-phenylmethoxyphenyl)-1,1-dioxo-2-(2-trimethylsilylethyl)-1,2,5-thiadiazolidin-3-one (PubChem CID 66756937) has the molecular formula C20H25IN2O4SSi and a molecular weight of 544.49 g/mol. Its IUPAC name is 5-(4-iodo-2-phenylmethoxyphenyl)-1,1-dioxo-2-(2-trimethylsilylethyl)-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-(4-iodo-2-phenylmethoxyphenyl)-1,1-dioxo-2-(2-trimethylsilylethyl)-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 66756937 |
| Molecular Formula | C20H25IN2O4SSi |
| Molecular Weight | 544.49 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | 5-(4-iodo-2-phenylmethoxyphenyl)-1,1-dioxo-2-(2-trimethylsilylethyl)-1,2,5-thiadiazolidin-3-one |
| SMILES | C[Si](C)(C)CCN1C(=O)CN(c2ccc(I)cc2OCc2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C20H25IN2O4SSi/c1-29(2,3)12-11-22-20(24)14-23(28(22,25)26)18-10-9-17(21)13-19(18)27-15-16-7-5-4-6-8-16/h4-10,13H,11-12,14-15H2,1-3H3 |
| InChIKey | UMPCRQWRRIQOMZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|