C27H32N3O6S2Si- — CID 123938823
3-hydroxy-1,1-dioxo-5-[2-phenylmethoxy-4-[[2-(sulfinatoamino)phenyl]methyl]phenyl]-2-(2-trimethylsilylethyl)-1,2,5-thiadiazole (PubChem CID 123938823) has the molecular formula C27H32N3O6S2Si- and a molecular weight of 586.79 g/mol. Its IUPAC name is 3-hydroxy-1,1-dioxo-5-[2-phenylmethoxy-4-[[2-(sulfinatoamino)phenyl]methyl]phenyl]-2-(2-trimethylsilylethyl)-1,2,5-thiadiazole.
| Compound Name | 3-hydroxy-1,1-dioxo-5-[2-phenylmethoxy-4-[[2-(sulfinatoamino)phenyl]methyl]phenyl]-2-(2-trimethylsilylethyl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 123938823 |
| Molecular Formula | C27H32N3O6S2Si- |
| Molecular Weight | 586.79 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | 3-hydroxy-1,1-dioxo-5-[2-phenylmethoxy-4-[[2-(sulfinatoamino)phenyl]methyl]phenyl]-2-(2-trimethylsilylethyl)-1,2,5-thiadiazole |
| SMILES | C[Si](C)(C)CCN1C(O)=CN(c2ccc(Cc3ccccc3NS(=O)[O-])cc2OCc2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C27H33N3O6S2Si/c1-39(2,3)16-15-29-27(31)19-30(38(29,34)35)25-14-13-22(17-23-11-7-8-12-24(23)28-37(32)33)18-26(25)36-20-21-9-5-4-6-10-21/h4-14,18-19,28,31H,15-17,20H2,1-3H3,(H,32,33)/p-1 |
| InChIKey | VFEUJTMJQDRXLR-UHFFFAOYSA-M |
| XLogP | 5.12 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.79 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|