C30H40N6O6SSi — CID 159881291
3-hydroxytriazolo[4,5-b]pyridine;5-[5-(3-methylbutoxy)-2-phenylmethoxyphenyl]-1,1-dioxo-2-(2-trimethylsilylethyl)-1,2,5-thiadiazolidin-3-one (PubChem CID 159881291) has the molecular formula C30H40N6O6SSi and a molecular weight of 640.84 g/mol. Its IUPAC name is 3-hydroxytriazolo[4,5-b]pyridine;5-[5-(3-methylbutoxy)-2-phenylmethoxyphenyl]-1,1-dioxo-2-(2-trimethylsilylethyl)-1,2,5-thiadiazolidin-3-one.
| Compound Name | 3-hydroxytriazolo[4,5-b]pyridine;5-[5-(3-methylbutoxy)-2-phenylmethoxyphenyl]-1,1-dioxo-2-(2-trimethylsilylethyl)-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 159881291 |
| Molecular Formula | C30H40N6O6SSi |
| Molecular Weight | 640.84 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | 3-hydroxytriazolo[4,5-b]pyridine;5-[5-(3-methylbutoxy)-2-phenylmethoxyphenyl]-1,1-dioxo-2-(2-trimethylsilylethyl)-1,2,5-thiadiazolidin-3-one |
| SMILES | CC(C)CCOc1ccc(OCc2ccccc2)c(N2CC(=O)N(CC[Si](C)(C)C)S2(=O)=O)c1.On1nnc2cccnc21 |
| InChI | InChI=1S/C25H36N2O5SSi.C5H4N4O/c1-20(2)13-15-31-22-11-12-24(32-19-21-9-7-6-8-10-21)23(17-22)27-18-25(28)26(33(27,29)30)14-16-34(3,4)5;10-9-5-4(7-8-9)2-1-3-6-5/h6-12,17,20H,13-16,18-19H2,1-5H3;1-3,10H |
| InChIKey | NTODNBZAIPUZFG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.84 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|