C24H26FN3O5S — CID 162690217
2-[1-fluoro-3-phenylmethoxy-7-[2-(propan-2-ylamino)ethoxy]naphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 162690217) has the molecular formula C24H26FN3O5S and a molecular weight of 487.55 g/mol. Its IUPAC name is 2-[1-fluoro-3-phenylmethoxy-7-[2-(propan-2-ylamino)ethoxy]naphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 2-[1-fluoro-3-phenylmethoxy-7-[2-(propan-2-ylamino)ethoxy]naphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 162690217 |
| Molecular Formula | C24H26FN3O5S |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 2-[1-fluoro-3-phenylmethoxy-7-[2-(propan-2-ylamino)ethoxy]naphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | CC(C)NCCOc1ccc2cc(OCc3ccccc3)c(N3C(=O)CNS3(=O)=O)c(F)c2c1 |
| InChI | InChI=1S/C24H26FN3O5S/c1-16(2)26-10-11-32-19-9-8-18-12-21(33-15-17-6-4-3-5-7-17)24(23(25)20(18)13-19)28-22(29)14-27-34(28,30)31/h3-9,12-13,16,26-27H,10-11,14-15H2,1-2H3 |
| InChIKey | FJFYRWCKIASSKJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|