C24H25FN2O6S — CID 156799192
2-[1-fluoro-7-(4-hydroxybutoxy)-3-phenylmethoxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde (PubChem CID 156799192) has the molecular formula C24H25FN2O6S and a molecular weight of 488.54 g/mol. Its IUPAC name is 2-[1-fluoro-7-(4-hydroxybutoxy)-3-phenylmethoxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde.
| Compound Name | 2-[1-fluoro-7-(4-hydroxybutoxy)-3-phenylmethoxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 156799192 |
| Molecular Formula | C24H25FN2O6S |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 2-[1-fluoro-7-(4-hydroxybutoxy)-3-phenylmethoxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde |
| SMILES | O=CC1CNS(=O)(=O)N1c1c(OCc2ccccc2)cc2ccc(OCCCCO)cc2c1F |
| InChI | InChI=1S/C24H25FN2O6S/c25-23-21-13-20(32-11-5-4-10-28)9-8-18(21)12-22(33-16-17-6-2-1-3-7-17)24(23)27-19(15-29)14-26-34(27,30)31/h1-3,6-9,12-13,15,19,26,28H,4-5,10-11,14,16H2 |
| InChIKey | HEYNBPXYMPKHLP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|