C23H22FN2O6S+ — CID 156798946
4-[8-fluoro-6-phenylmethoxy-7-(1,1,5-trioxo-1,2,5-thiadiazolidin-5-ium-2-yl)naphthalen-2-yl]oxybutanal (PubChem CID 156798946) has the molecular formula C23H22FN2O6S+ and a molecular weight of 473.50 g/mol. Its IUPAC name is 4-[8-fluoro-6-phenylmethoxy-7-(1,1,5-trioxo-1,2,5-thiadiazolidin-5-ium-2-yl)naphthalen-2-yl]oxybutanal.
| Compound Name | 4-[8-fluoro-6-phenylmethoxy-7-(1,1,5-trioxo-1,2,5-thiadiazolidin-5-ium-2-yl)naphthalen-2-yl]oxybutanal |
|---|---|
| PubChem CID | 156798946 |
| Molecular Formula | C23H22FN2O6S+ |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 4-[8-fluoro-6-phenylmethoxy-7-(1,1,5-trioxo-1,2,5-thiadiazolidin-5-ium-2-yl)naphthalen-2-yl]oxybutanal |
| SMILES | O=CCCCOc1ccc2cc(OCc3ccccc3)c(N3CC[N+](=O)S3(=O)=O)c(F)c2c1 |
| InChI | InChI=1S/C23H22FN2O6S/c24-22-20-15-19(31-13-5-4-12-27)9-8-18(20)14-21(32-16-17-6-2-1-3-7-17)23(22)25-10-11-26(28)33(25,29)30/h1-3,6-9,12,14-15H,4-5,10-11,13,16H2/q+1 |
| InChIKey | XBUJLAFHNWWOLV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|