C24H36N2O6SSi — CID 69257205
[5-(3-methylbutoxy)-2-phenylmethoxyphenyl] N-sulfamoyl-N-(2-trimethylsilylethyl)carbamate (PubChem CID 69257205) has the molecular formula C24H36N2O6SSi and a molecular weight of 508.71 g/mol. Its IUPAC name is [5-(3-methylbutoxy)-2-phenylmethoxyphenyl] N-sulfamoyl-N-(2-trimethylsilylethyl)carbamate.
| Compound Name | [5-(3-methylbutoxy)-2-phenylmethoxyphenyl] N-sulfamoyl-N-(2-trimethylsilylethyl)carbamate |
|---|---|
| PubChem CID | 69257205 |
| Molecular Formula | C24H36N2O6SSi |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | [5-(3-methylbutoxy)-2-phenylmethoxyphenyl] N-sulfamoyl-N-(2-trimethylsilylethyl)carbamate |
| SMILES | CC(C)CCOc1ccc(OCc2ccccc2)c(OC(=O)N(CC[Si](C)(C)C)S(N)(=O)=O)c1 |
| InChI | InChI=1S/C24H36N2O6SSi/c1-19(2)13-15-30-21-11-12-22(31-18-20-9-7-6-8-10-20)23(17-21)32-24(27)26(33(25,28)29)14-16-34(3,4)5/h6-12,17,19H,13-16,18H2,1-5H3,(H2,25,28,29) |
| InChIKey | RKAUWPYXTMQVST-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|