C26H38N2O3 — CID 71159128
benzyl N-[(3S)-3-amino-4-(4-butoxyphenyl)butyl]-N-(2-methylpropyl)carbamate (PubChem CID 71159128) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is benzyl N-[(3S)-3-amino-4-(4-butoxyphenyl)butyl]-N-(2-methylpropyl)carbamate.
| Compound Name | benzyl N-[(3S)-3-amino-4-(4-butoxyphenyl)butyl]-N-(2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 71159128 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | benzyl N-[(3S)-3-amino-4-(4-butoxyphenyl)butyl]-N-(2-methylpropyl)carbamate |
| SMILES | CCCCOc1ccc(C[C@H](N)CCN(CC(C)C)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H38N2O3/c1-4-5-17-30-25-13-11-22(12-14-25)18-24(27)15-16-28(19-21(2)3)26(29)31-20-23-9-7-6-8-10-23/h6-14,21,24H,4-5,15-20,27H2,1-3H3/t24-/m1/s1 |
| InChIKey | MVIAZWIZALQLDF-XMMPIXPASA-N |
| XLogP | 5.42 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|