C28H41N3O6SSiZn — CID 157472020
tert-butyl N-[3-[3-phenylmethoxy-4-[1,1,4-trioxo-5-(2-trimethylsilylethyl)-1,2,5-thiadiazolidin-2-yl]phenyl]propyl]carbamate;zinc (PubChem CID 157472020) has the molecular formula C28H41N3O6SSiZn and a molecular weight of 641.19 g/mol. Its IUPAC name is tert-butyl N-[3-[3-phenylmethoxy-4-[1,1,4-trioxo-5-(2-trimethylsilylethyl)-1,2,5-thiadiazolidin-2-yl]phenyl]propyl]carbamate;zinc.
| Compound Name | tert-butyl N-[3-[3-phenylmethoxy-4-[1,1,4-trioxo-5-(2-trimethylsilylethyl)-1,2,5-thiadiazolidin-2-yl]phenyl]propyl]carbamate;zinc |
|---|---|
| PubChem CID | 157472020 |
| Molecular Formula | C28H41N3O6SSiZn |
| Molecular Weight | 641.19 g/mol |
| Exact Mass | 639.18 |
| IUPAC Name | tert-butyl N-[3-[3-phenylmethoxy-4-[1,1,4-trioxo-5-(2-trimethylsilylethyl)-1,2,5-thiadiazolidin-2-yl]phenyl]propyl]carbamate;zinc |
| SMILES | CC(C)(C)OC(=O)NCCCc1ccc(N2CC(=O)N(CC[Si](C)(C)C)S2(=O)=O)c(OCc2ccccc2)c1.[Zn] |
| InChI | InChI=1S/C28H41N3O6SSi.Zn/c1-28(2,3)37-27(33)29-16-10-13-22-14-15-24(25(19-22)36-21-23-11-8-7-9-12-23)31-20-26(32)30(38(31,34)35)17-18-39(4,5)6;/h7-9,11-12,14-15,19H,10,13,16-18,20-21H2,1-6H3,(H,29,33); |
| InChIKey | BVDMMLJEDUSELG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.19 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|