C24H27INO3S+ — CID 73334062
[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-phenylmethoxyphenyl]-thiophen-2-yliodanium (PubChem CID 73334062) has the molecular formula C24H27INO3S+ and a molecular weight of 536.46 g/mol. Its IUPAC name is [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-phenylmethoxyphenyl]-thiophen-2-yliodanium.
| Compound Name | [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-phenylmethoxyphenyl]-thiophen-2-yliodanium |
|---|---|
| PubChem CID | 73334062 |
| Molecular Formula | C24H27INO3S+ |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-phenylmethoxyphenyl]-thiophen-2-yliodanium |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc([I+]c2cccs2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C24H26INO3S/c1-24(2,3)29-23(27)26-14-13-18-11-12-20(25-22-10-7-15-30-22)21(16-18)28-17-19-8-5-4-6-9-19/h4-12,15-16H,13-14,17H2,1-3H3/p+1 |
| InChIKey | BQEBBABQLPQPOK-UHFFFAOYSA-O |
| XLogP | 2.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|