C31H37N3O4SSi — CID 68994521
1,1-dioxo-5-[2-phenylmethoxy-4-[(E)-2-(1,2,3,4-tetrahydroisoquinolin-3-yl)ethenyl]phenyl]-2-(2-trimethylsilylethyl)-1,2,5-thiadiazolidin-3-one (PubChem CID 68994521) has the molecular formula C31H37N3O4SSi and a molecular weight of 575.81 g/mol. Its IUPAC name is 1,1-dioxo-5-[2-phenylmethoxy-4-[(E)-2-(1,2,3,4-tetrahydroisoquinolin-3-yl)ethenyl]phenyl]-2-(2-trimethylsilylethyl)-1,2,5-thiadiazolidin-3-one.
| Compound Name | 1,1-dioxo-5-[2-phenylmethoxy-4-[(E)-2-(1,2,3,4-tetrahydroisoquinolin-3-yl)ethenyl]phenyl]-2-(2-trimethylsilylethyl)-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 68994521 |
| Molecular Formula | C31H37N3O4SSi |
| Molecular Weight | 575.81 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 1,1-dioxo-5-[2-phenylmethoxy-4-[(E)-2-(1,2,3,4-tetrahydroisoquinolin-3-yl)ethenyl]phenyl]-2-(2-trimethylsilylethyl)-1,2,5-thiadiazolidin-3-one |
| SMILES | C[Si](C)(C)CCN1C(=O)CN(c2ccc(/C=C/C3Cc4ccccc4CN3)cc2OCc2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C31H37N3O4SSi/c1-40(2,3)18-17-33-31(35)22-34(39(33,36)37)29-16-14-24(19-30(29)38-23-25-9-5-4-6-10-25)13-15-28-20-26-11-7-8-12-27(26)21-32-28/h4-16,19,28,32H,17-18,20-23H2,1-3H3/b15-13+ |
| InChIKey | BODHIZQDXKGNDY-FYWRMAATSA-N |
| XLogP | 5.22 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.81 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|