C12H19NO4S — CID 667560
(2R,6R)-1-(3-acetylsulfanylpropanoyl)-6-methylpiperidine-2-carboxylic acid (PubChem CID 667560) has the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. Its IUPAC name is (2R,6R)-1-(3-acetylsulfanylpropanoyl)-6-methylpiperidine-2-carboxylic acid.
| Compound Name | (2R,6R)-1-(3-acetylsulfanylpropanoyl)-6-methylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 667560 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (2R,6R)-1-(3-acetylsulfanylpropanoyl)-6-methylpiperidine-2-carboxylic acid |
| SMILES | CC(=O)SCCC(=O)N1[C@H](C)CCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C12H19NO4S/c1-8-4-3-5-10(12(16)17)13(8)11(15)6-7-18-9(2)14/h8,10H,3-7H2,1-2H3,(H,16,17)/t8-,10-/m1/s1 |
| InChIKey | JHFOAISYWJRTIM-PSASIEDQSA-N |
| XLogP | 1.51 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|