About (2S)-2-amino-3-methylbutanoic acid;1H-imidazole
(2S)-2-amino-3-methylbutanoic acid;1H-imidazole (PubChem CID 66756430) has the molecular formula C8H15N3O2
and a molecular weight of 185.23 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoic acid;1H-imidazole.
Molecular Properties
| Compound Name | (2S)-2-amino-3-methylbutanoic acid;1H-imidazole |
| PubChem CID | 66756430 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoic acid;1H-imidazole |
| SMILES | CC(C)[C@H](N)C(=O)O.c1c[nH]cn1 |
| InChI | InChI=1S/C5H11NO2.C3H4N2/c1-3(2)4(6)5(7)8;1-2-5-3-4-1/h3-4H,6H2,1-2H3,(H,7,8);1-3H,(H,4,5)/t4-;/m0./s1 |
| InChIKey | ZBSFLLBRHNWUFE-WCCKRBBISA-N |
| XLogP | 0.46 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-amino-3-methylbutanoic acid;1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-methylbutanoic acid;1H-imidazole?
The IUPAC name of (2S)-2-amino-3-methylbutanoic acid;1H-imidazole (CID 66756430) is (2S)-2-amino-3-methylbutanoic acid;1H-imidazole.
What is the SMILES notation for (2S)-2-amino-3-methylbutanoic acid;1H-imidazole?
The canonical SMILES for (2S)-2-amino-3-methylbutanoic acid;1H-imidazole is CC(C)[C@H](N)C(=O)O.c1c[nH]cn1.
What is the InChIKey of (2S)-2-amino-3-methylbutanoic acid;1H-imidazole?
The InChIKey is ZBSFLLBRHNWUFE-WCCKRBBISA-N. The full InChI is InChI=1S/C5H11NO2.C3H4N2/c1-3(2)4(6)5(7)8;1-2-5-3-4-1/h3-4H,6H2,1-2H3,(H,7,8);1-3H,(H,4,5)/t4-;/m0./s1.
What are the key properties of (2S)-2-amino-3-methylbutanoic acid;1H-imidazole?
(2S)-2-amino-3-methylbutanoic acid;1H-imidazole has a molecular weight of 185.23 g/mol, XLogP of 0.46, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-methylbutanoic acid;1H-imidazole is sourced from PubChem (CID 66756430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).