C23H30N6O3S — CID 66758804
1-[4-(5-amino-2-pentyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)piperazin-1-yl]-2-(4-methoxyphenoxy)ethanone (PubChem CID 66758804) has the molecular formula C23H30N6O3S and a molecular weight of 470.60 g/mol. Its IUPAC name is 1-[4-(5-amino-2-pentyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)piperazin-1-yl]-2-(4-methoxyphenoxy)ethanone.
| Compound Name | 1-[4-(5-amino-2-pentyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)piperazin-1-yl]-2-(4-methoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 66758804 |
| Molecular Formula | C23H30N6O3S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 1-[4-(5-amino-2-pentyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)piperazin-1-yl]-2-(4-methoxyphenoxy)ethanone |
| SMILES | CCCCCc1nc2c(N3CCN(C(=O)COc4ccc(OC)cc4)CC3)nc(N)nc2s1 |
| InChI | InChI=1S/C23H30N6O3S/c1-3-4-5-6-18-25-20-21(26-23(24)27-22(20)33-18)29-13-11-28(12-14-29)19(30)15-32-17-9-7-16(31-2)8-10-17/h7-10H,3-6,11-15H2,1-2H3,(H2,24,26,27) |
| InChIKey | NIILYBAXFOQFJE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|