C23H23FN4O2 — CID 66759494
[5-[[4-(3-tert-butylanilino)-5-fluoropyrimidin-2-yl]amino]-3H-1-benzofuran-2-ylidene]methanol (PubChem CID 66759494) has the molecular formula C23H23FN4O2 and a molecular weight of 406.46 g/mol. Its IUPAC name is [5-[[4-(3-tert-butylanilino)-5-fluoropyrimidin-2-yl]amino]-3H-1-benzofuran-2-ylidene]methanol.
| Compound Name | [5-[[4-(3-tert-butylanilino)-5-fluoropyrimidin-2-yl]amino]-3H-1-benzofuran-2-ylidene]methanol |
|---|---|
| PubChem CID | 66759494 |
| Molecular Formula | C23H23FN4O2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | [5-[[4-(3-tert-butylanilino)-5-fluoropyrimidin-2-yl]amino]-3H-1-benzofuran-2-ylidene]methanol |
| SMILES | CC(C)(C)c1cccc(Nc2nc(Nc3ccc4c(c3)CC(=CO)O4)ncc2F)c1 |
| InChI | InChI=1S/C23H23FN4O2/c1-23(2,3)15-5-4-6-16(11-15)26-21-19(24)12-25-22(28-21)27-17-7-8-20-14(9-17)10-18(13-29)30-20/h4-9,11-13,29H,10H2,1-3H3,(H2,25,26,27,28) |
| InChIKey | AWKSVEGTJGXBBI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|