About 5-[bromo-(2,4-difluorophenyl)methyl]-4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazole
5-[bromo-(2,4-difluorophenyl)methyl]-4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazole (PubChem CID 66765584) has the molecular formula C18H13BrClF3N2
and a molecular weight of 429.67 g/mol. Its IUPAC name is 5-[bromo-(2,4-difluorophenyl)methyl]-4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazole.
Molecular Properties
| Compound Name | 5-[bromo-(2,4-difluorophenyl)methyl]-4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazole |
| PubChem CID | 66765584 |
| Molecular Formula | C18H13BrClF3N2 |
| Molecular Weight | 429.67 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | 5-[bromo-(2,4-difluorophenyl)methyl]-4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(C(Br)c2ccc(F)cc2F)c1-c1ccc(F)cc1Cl |
| InChI | InChI=1S/C18H13BrClF3N2/c1-9-16(12-5-3-10(21)7-14(12)20)18(25(2)24-9)17(19)13-6-4-11(22)8-15(13)23/h3-8,17H,1-2H3 |
| InChIKey | LPRPBENKTGBCLH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.67 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[bromo-(2,4-difluorophenyl)methyl]-4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[bromo-(2,4-difluorophenyl)methyl]-4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazole?
The IUPAC name of 5-[bromo-(2,4-difluorophenyl)methyl]-4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazole (CID 66765584) is 5-[bromo-(2,4-difluorophenyl)methyl]-4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazole.
What is the SMILES notation for 5-[bromo-(2,4-difluorophenyl)methyl]-4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazole?
The canonical SMILES for 5-[bromo-(2,4-difluorophenyl)methyl]-4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazole is Cc1nn(C)c(C(Br)c2ccc(F)cc2F)c1-c1ccc(F)cc1Cl.
What is the InChIKey of 5-[bromo-(2,4-difluorophenyl)methyl]-4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazole?
The InChIKey is LPRPBENKTGBCLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrClF3N2/c1-9-16(12-5-3-10(21)7-14(12)20)18(25(2)24-9)17(19)13-6-4-11(22)8-15(13)23/h3-8,17H,1-2H3.
What are the key properties of 5-[bromo-(2,4-difluorophenyl)methyl]-4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazole?
5-[bromo-(2,4-difluorophenyl)methyl]-4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazole has a molecular weight of 429.67 g/mol, XLogP of 5.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[bromo-(2,4-difluorophenyl)methyl]-4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazole is sourced from PubChem (CID 66765584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).