C22H28ClNO — CID 66767129
(4R)-4-(4-chlorophenyl)-2-methyl-6-(1-phenylpropylamino)hexan-3-one (PubChem CID 66767129) has the molecular formula C22H28ClNO and a molecular weight of 357.93 g/mol. Its IUPAC name is (4R)-4-(4-chlorophenyl)-2-methyl-6-(1-phenylpropylamino)hexan-3-one.
| Compound Name | (4R)-4-(4-chlorophenyl)-2-methyl-6-(1-phenylpropylamino)hexan-3-one |
|---|---|
| PubChem CID | 66767129 |
| Molecular Formula | C22H28ClNO |
| Molecular Weight | 357.93 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (4R)-4-(4-chlorophenyl)-2-methyl-6-(1-phenylpropylamino)hexan-3-one |
| SMILES | CCC(NCCC(C(=O)C(C)C)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H28ClNO/c1-4-21(18-8-6-5-7-9-18)24-15-14-20(22(25)16(2)3)17-10-12-19(23)13-11-17/h5-13,16,20-21,24H,4,14-15H2,1-3H3 |
| InChIKey | DELIITQSACVUQB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.93 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |