C30H18O4 — CID 6677
2-methyl-1-(2-methyl-9,10-dioxoanthracen-1-yl)anthracene-9,10-dione (PubChem CID 6677) has the molecular formula C30H18O4 and a molecular weight of 442.47 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-9,10-dioxoanthracen-1-yl)anthracene-9,10-dione.
| Compound Name | 2-methyl-1-(2-methyl-9,10-dioxoanthracen-1-yl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 6677 |
| Molecular Formula | C30H18O4 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-methyl-1-(2-methyl-9,10-dioxoanthracen-1-yl)anthracene-9,10-dione |
| SMILES | Cc1ccc2c(c1-c1c(C)ccc3c1C(=O)c1ccccc1C3=O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C30H18O4/c1-15-11-13-21-25(29(33)19-9-5-3-7-17(19)27(21)31)23(15)24-16(2)12-14-22-26(24)30(34)20-10-6-4-8-18(20)28(22)32/h3-14H,1-2H3 |
| InChIKey | SOHQSWHUIQYXPT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|