C22H22F3NO2 — CID 66772776
3-[1-benzyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-yl]prop-2-enoic acid (PubChem CID 66772776) has the molecular formula C22H22F3NO2 and a molecular weight of 389.42 g/mol. Its IUPAC name is 3-[1-benzyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-yl]prop-2-enoic acid.
| Compound Name | 3-[1-benzyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66772776 |
| Molecular Formula | C22H22F3NO2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 3-[1-benzyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=CC1(c2cccc(C(F)(F)F)c2)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H22F3NO2/c23-22(24,25)19-8-4-7-18(15-19)21(10-9-20(27)28)11-13-26(14-12-21)16-17-5-2-1-3-6-17/h1-10,15H,11-14,16H2,(H,27,28) |
| InChIKey | ARRGJEGSXGSDSJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|