C22H25F3N2O2 — CID 67542716
[1-benzyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-yl]methyl-methylcarbamic acid (PubChem CID 67542716) has the molecular formula C22H25F3N2O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is [1-benzyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-yl]methyl-methylcarbamic acid.
| Compound Name | [1-benzyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-yl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 67542716 |
| Molecular Formula | C22H25F3N2O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [1-benzyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-yl]methyl-methylcarbamic acid |
| SMILES | CN(CC1(c2cccc(C(F)(F)F)c2)CCN(Cc2ccccc2)CC1)C(=O)O |
| InChI | InChI=1S/C22H25F3N2O2/c1-26(20(28)29)16-21(18-8-5-9-19(14-18)22(23,24)25)10-12-27(13-11-21)15-17-6-3-2-4-7-17/h2-9,14H,10-13,15-16H2,1H3,(H,28,29) |
| InChIKey | YKKLSHKIDBFAEH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |