C31H39F3N2O9 — CID 157050111
oxalic acid;1-(2-phenylethyl)-4-(2-piperidin-1-ylethoxy)-4-[3-(trifluoromethyl)phenyl]piperidine (PubChem CID 157050111) has the molecular formula C31H39F3N2O9 and a molecular weight of 640.65 g/mol. Its IUPAC name is oxalic acid;1-(2-phenylethyl)-4-(2-piperidin-1-ylethoxy)-4-[3-(trifluoromethyl)phenyl]piperidine.
| Compound Name | oxalic acid;1-(2-phenylethyl)-4-(2-piperidin-1-ylethoxy)-4-[3-(trifluoromethyl)phenyl]piperidine |
|---|---|
| PubChem CID | 157050111 |
| Molecular Formula | C31H39F3N2O9 |
| Molecular Weight | 640.65 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | oxalic acid;1-(2-phenylethyl)-4-(2-piperidin-1-ylethoxy)-4-[3-(trifluoromethyl)phenyl]piperidine |
| SMILES | FC(F)(F)c1cccc(C2(OCCN3CCCCC3)CCN(CCc3ccccc3)CC2)c1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H35F3N2O.2C2H2O4/c28-27(29,30)25-11-7-10-24(22-25)26(33-21-20-31-15-5-2-6-16-31)13-18-32(19-14-26)17-12-23-8-3-1-4-9-23;2*3-1(4)2(5)6/h1,3-4,7-11,22H,2,5-6,12-21H2;2*(H,3,4)(H,5,6) |
| InChIKey | AACGDXGJAMPTIF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 164.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.65 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|