C18H24N4O2 — CID 66772900
3-[[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]-1-ethylindazole-4-carboxylic acid (PubChem CID 66772900) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 3-[[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]-1-ethylindazole-4-carboxylic acid.
| Compound Name | 3-[[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]-1-ethylindazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66772900 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 3-[[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]-1-ethylindazole-4-carboxylic acid |
| SMILES | CCn1nc(CN[C@H]2CN3CCC2CC3)c2c(C(=O)O)cccc21 |
| InChI | InChI=1S/C18H24N4O2/c1-2-22-16-5-3-4-13(18(23)24)17(16)14(20-22)10-19-15-11-21-8-6-12(15)7-9-21/h3-5,12,15,19H,2,6-11H2,1H3,(H,23,24)/t15-/m0/s1 |
| InChIKey | PRGRWWMOOFTPOV-HNNXBMFYSA-N |
| XLogP | 1.94 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |