C23H26N4O2 — CID 66772486
3-[(1-azabicyclo[2.2.2]octan-3-ylamino)methyl]-1-benzylindazole-4-carboxylic acid (PubChem CID 66772486) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 3-[(1-azabicyclo[2.2.2]octan-3-ylamino)methyl]-1-benzylindazole-4-carboxylic acid.
| Compound Name | 3-[(1-azabicyclo[2.2.2]octan-3-ylamino)methyl]-1-benzylindazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66772486 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 3-[(1-azabicyclo[2.2.2]octan-3-ylamino)methyl]-1-benzylindazole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1c(CNC1CN3CCC1CC3)nn2Cc1ccccc1 |
| InChI | InChI=1S/C23H26N4O2/c28-23(29)18-7-4-8-21-22(18)19(25-27(21)14-16-5-2-1-3-6-16)13-24-20-15-26-11-9-17(20)10-12-26/h1-8,17,20,24H,9-15H2,(H,28,29) |
| InChIKey | RSRQPHXPBYEPPQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |