C23H24IN5O5 — CID 66773512
[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)-3-iodopiperazin-1-yl]-(2,3-dihydro-1,4-benzodioxin-3-yl)methanone (PubChem CID 66773512) has the molecular formula C23H24IN5O5 and a molecular weight of 577.38 g/mol. Its IUPAC name is [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)-3-iodopiperazin-1-yl]-(2,3-dihydro-1,4-benzodioxin-3-yl)methanone.
| Compound Name | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)-3-iodopiperazin-1-yl]-(2,3-dihydro-1,4-benzodioxin-3-yl)methanone |
|---|---|
| PubChem CID | 66773512 |
| Molecular Formula | C23H24IN5O5 |
| Molecular Weight | 577.38 g/mol |
| Exact Mass | 577.08 |
| IUPAC Name | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)-3-iodopiperazin-1-yl]-(2,3-dihydro-1,4-benzodioxin-3-yl)methanone |
| SMILES | COc1cc2nc(N3CCN(C(=O)C4COc5ccccc5O4)CC3I)nc(N)c2cc1OC |
| InChI | InChI=1S/C23H24IN5O5/c1-31-17-9-13-14(10-18(17)32-2)26-23(27-21(13)25)29-8-7-28(11-20(29)24)22(30)19-12-33-15-5-3-4-6-16(15)34-19/h3-6,9-10,19-20H,7-8,11-12H2,1-2H3,(H2,25,26,27) |
| InChIKey | LHJXGQPFVQEALF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|