C25H29N3O4 — CID 66779045
N-benzyl-2-[(2S)-2-(2-phenoxyacetyl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxamide (PubChem CID 66779045) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-benzyl-2-[(2S)-2-(2-phenoxyacetyl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxamide.
| Compound Name | N-benzyl-2-[(2S)-2-(2-phenoxyacetyl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 66779045 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N-benzyl-2-[(2S)-2-(2-phenoxyacetyl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(COc1ccccc1)[C@@H]1CCCN1C(=O)C1CCCN1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H29N3O4/c29-23(18-32-20-11-5-2-6-12-20)21-13-7-15-27(21)24(30)22-14-8-16-28(22)25(31)26-17-19-9-3-1-4-10-19/h1-6,9-12,21-22H,7-8,13-18H2,(H,26,31)/t21-,22?/m0/s1 |
| InChIKey | VJKKRYPFGGNQFE-HMTLIYDFSA-N |
| XLogP | 3.00 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |