C23H23N3O2 — CID 66780186
N-methyl-N-[(3-methyl-1H-inden-2-yl)methyl]-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enamide (PubChem CID 66780186) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-methyl-N-[(3-methyl-1H-inden-2-yl)methyl]-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enamide.
| Compound Name | N-methyl-N-[(3-methyl-1H-inden-2-yl)methyl]-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 66780186 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-methyl-N-[(3-methyl-1H-inden-2-yl)methyl]-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enamide |
| SMILES | CC1=C(CN(C)C(=O)C=Cc2cnc3c(c2)CCC(=O)N3)Cc2ccccc21 |
| InChI | InChI=1S/C23H23N3O2/c1-15-19(12-17-5-3-4-6-20(15)17)14-26(2)22(28)10-7-16-11-18-8-9-21(27)25-23(18)24-13-16/h3-7,10-11,13H,8-9,12,14H2,1-2H3,(H,24,25,27) |
| InChIKey | GPADCNLCKDHJRI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|