C28H26N4O2 — CID 10343753
(E)-N-[(1-benzylindol-3-yl)methyl]-N-methyl-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enamide (PubChem CID 10343753) has the molecular formula C28H26N4O2 and a molecular weight of 450.54 g/mol. Its IUPAC name is (E)-N-[(1-benzylindol-3-yl)methyl]-N-methyl-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enamide.
| Compound Name | (E)-N-[(1-benzylindol-3-yl)methyl]-N-methyl-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 10343753 |
| Molecular Formula | C28H26N4O2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | (E)-N-[(1-benzylindol-3-yl)methyl]-N-methyl-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enamide |
| SMILES | CN(Cc1cn(Cc2ccccc2)c2ccccc12)C(=O)/C=C/c1cnc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C28H26N4O2/c1-31(27(34)14-11-21-15-22-12-13-26(33)30-28(22)29-16-21)18-23-19-32(17-20-7-3-2-4-8-20)25-10-6-5-9-24(23)25/h2-11,14-16,19H,12-13,17-18H2,1H3,(H,29,30,33)/b14-11+ |
| InChIKey | VIYCLDYAFQLPDA-SDNWHVSQSA-N |
| XLogP | 4.64 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|