C24H24N4O4 — CID 66905339
methyl 6-[3-[methyl-[(1-methylindol-3-yl)methyl]amino]-3-oxoprop-1-enyl]-2-oxo-3,4-dihydro-1H-1,8-naphthyridine-3-carboxylate (PubChem CID 66905339) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is methyl 6-[3-[methyl-[(1-methylindol-3-yl)methyl]amino]-3-oxoprop-1-enyl]-2-oxo-3,4-dihydro-1H-1,8-naphthyridine-3-carboxylate.
| Compound Name | methyl 6-[3-[methyl-[(1-methylindol-3-yl)methyl]amino]-3-oxoprop-1-enyl]-2-oxo-3,4-dihydro-1H-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 66905339 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | methyl 6-[3-[methyl-[(1-methylindol-3-yl)methyl]amino]-3-oxoprop-1-enyl]-2-oxo-3,4-dihydro-1H-1,8-naphthyridine-3-carboxylate |
| SMILES | COC(=O)C1Cc2cc(C=CC(=O)N(C)Cc3cn(C)c4ccccc34)cnc2NC1=O |
| InChI | InChI=1S/C24H24N4O4/c1-27-13-17(18-6-4-5-7-20(18)27)14-28(2)21(29)9-8-15-10-16-11-19(24(31)32-3)23(30)26-22(16)25-12-15/h4-10,12-13,19H,11,14H2,1-3H3,(H,25,26,30) |
| InChIKey | BIELWRCUXGLKPQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|