C22H39NO2 — CID 66783087
3-[(Z)-octadec-9-enyl]pyrrolidine-2,5-dione (PubChem CID 66783087) has the molecular formula C22H39NO2 and a molecular weight of 349.56 g/mol. Its IUPAC name is 3-[(Z)-octadec-9-enyl]pyrrolidine-2,5-dione.
| Compound Name | 3-[(Z)-octadec-9-enyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 66783087 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.30 |
| IUPAC Name | 3-[(Z)-octadec-9-enyl]pyrrolidine-2,5-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC1CC(=O)NC1=O |
| InChI | InChI=1S/C22H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-19-21(24)23-22(20)25/h9-10,20H,2-8,11-19H2,1H3,(H,23,24,25)/b10-9- |
| InChIKey | LIHOSTPQKUOLMC-KTKRTIGZSA-N |
| XLogP | 6.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|