C33H38N4O3 — CID 66785408
[(3R,4S)-4-amino-1-(naphthalene-2-carbonyl)pyrrolidin-3-yl]-[(3R)-3-[1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]methanone (PubChem CID 66785408) has the molecular formula C33H38N4O3 and a molecular weight of 538.69 g/mol. Its IUPAC name is [(3R,4S)-4-amino-1-(naphthalene-2-carbonyl)pyrrolidin-3-yl]-[(3R)-3-[1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]methanone.
| Compound Name | [(3R,4S)-4-amino-1-(naphthalene-2-carbonyl)pyrrolidin-3-yl]-[(3R)-3-[1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 66785408 |
| Molecular Formula | C33H38N4O3 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | [(3R,4S)-4-amino-1-(naphthalene-2-carbonyl)pyrrolidin-3-yl]-[(3R)-3-[1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]methanone |
| SMILES | COCCCn1c([C@@H]2CCCN(C(=O)[C@@H]3CN(C(=O)c4ccc5ccccc5c4)C[C@H]3N)C2)cc2ccccc21 |
| InChI | InChI=1S/C33H38N4O3/c1-40-17-7-16-37-30-12-5-4-10-25(30)19-31(37)27-11-6-15-35(20-27)33(39)28-21-36(22-29(28)34)32(38)26-14-13-23-8-2-3-9-24(23)18-26/h2-5,8-10,12-14,18-19,27-29H,6-7,11,15-17,20-22,34H2,1H3/t27-,28-,29-/m1/s1 |
| InChIKey | CQSGYLDPFFLGQG-MPFGFTFXSA-N |
| XLogP | 4.64 |
| TPSA | 80.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|