C22H24F4N4O — CID 66788385
2-cyclopropyl-N'-[4-(4-fluoro-4-phenylpiperidin-1-yl)-3-(trifluoromethyl)-2-pyridinyl]acetohydrazide (PubChem CID 66788385) has the molecular formula C22H24F4N4O and a molecular weight of 436.45 g/mol. Its IUPAC name is 2-cyclopropyl-N'-[4-(4-fluoro-4-phenylpiperidin-1-yl)-3-(trifluoromethyl)-2-pyridinyl]acetohydrazide.
| Compound Name | 2-cyclopropyl-N'-[4-(4-fluoro-4-phenylpiperidin-1-yl)-3-(trifluoromethyl)-2-pyridinyl]acetohydrazide |
|---|---|
| PubChem CID | 66788385 |
| Molecular Formula | C22H24F4N4O |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 2-cyclopropyl-N'-[4-(4-fluoro-4-phenylpiperidin-1-yl)-3-(trifluoromethyl)-2-pyridinyl]acetohydrazide |
| SMILES | O=C(CC1CC1)NNc1nccc(N2CCC(F)(c3ccccc3)CC2)c1C(F)(F)F |
| InChI | InChI=1S/C22H24F4N4O/c23-21(16-4-2-1-3-5-16)9-12-30(13-10-21)17-8-11-27-20(19(17)22(24,25)26)29-28-18(31)14-15-6-7-15/h1-5,8,11,15H,6-7,9-10,12-14H2,(H,27,29)(H,28,31) |
| InChIKey | CCZXWUGVDFJIJM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|