C21H27N5O — CID 118108239
2-cyclopropyl-N'-[4-methyl-5-(4-phenylpiperidin-1-yl)pyridazin-3-yl]acetohydrazide (PubChem CID 118108239) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is 2-cyclopropyl-N'-[4-methyl-5-(4-phenylpiperidin-1-yl)pyridazin-3-yl]acetohydrazide.
| Compound Name | 2-cyclopropyl-N'-[4-methyl-5-(4-phenylpiperidin-1-yl)pyridazin-3-yl]acetohydrazide |
|---|---|
| PubChem CID | 118108239 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 2-cyclopropyl-N'-[4-methyl-5-(4-phenylpiperidin-1-yl)pyridazin-3-yl]acetohydrazide |
| SMILES | Cc1c(N2CCC(c3ccccc3)CC2)cnnc1NNC(=O)CC1CC1 |
| InChI | InChI=1S/C21H27N5O/c1-15-19(14-22-24-21(15)25-23-20(27)13-16-7-8-16)26-11-9-18(10-12-26)17-5-3-2-4-6-17/h2-6,14,16,18H,7-13H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | IULUWQXLGSIXRQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|