C32H56N4O9 — CID 66790389
N-[2-[[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-[2-[3-(4-methylpiperazin-1-yl)propanoylamino]ethoxy]methoxy]ethyl]butanamide (PubChem CID 66790389) has the molecular formula C32H56N4O9 and a molecular weight of 640.82 g/mol. Its IUPAC name is N-[2-[[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-[2-[3-(4-methylpiperazin-1-yl)propanoylamino]ethoxy]methoxy]ethyl]butanamide.
| Compound Name | N-[2-[[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-[2-[3-(4-methylpiperazin-1-yl)propanoylamino]ethoxy]methoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 66790389 |
| Molecular Formula | C32H56N4O9 |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.40 |
| IUPAC Name | N-[2-[[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-[2-[3-(4-methylpiperazin-1-yl)propanoylamino]ethoxy]methoxy]ethyl]butanamide |
| SMILES | CCCC(=O)NCCOC(OCCNC(=O)CCN1CCN(C)CC1)c1cccc(OCCOCCOCCOCCOC)c1 |
| InChI | InChI=1S/C32H56N4O9/c1-4-6-30(37)33-10-17-44-32(45-18-11-34-31(38)9-12-36-15-13-35(2)14-16-36)28-7-5-8-29(27-28)43-26-25-42-24-23-41-22-21-40-20-19-39-3/h5,7-8,27,32H,4,6,9-26H2,1-3H3,(H,33,37)(H,34,38) |
| InChIKey | RUUNGOZBVAECNX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|