C33H38ClN3O2 — CID 66791624
(3R)-4-[4-(2-chlorophenyl)phenyl]-1-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-3-methylbutan-1-one (PubChem CID 66791624) has the molecular formula C33H38ClN3O2 and a molecular weight of 544.14 g/mol. Its IUPAC name is (3R)-4-[4-(2-chlorophenyl)phenyl]-1-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-3-methylbutan-1-one.
| Compound Name | (3R)-4-[4-(2-chlorophenyl)phenyl]-1-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 66791624 |
| Molecular Formula | C33H38ClN3O2 |
| Molecular Weight | 544.14 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | (3R)-4-[4-(2-chlorophenyl)phenyl]-1-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-3-methylbutan-1-one |
| SMILES | COCCCn1c([C@@H]2CCCN(C(=O)C[C@H](C)Cc3ccc(-c4ccccc4Cl)cc3)C2)nc2ccccc21 |
| InChI | InChI=1S/C33H38ClN3O2/c1-24(21-25-14-16-26(17-15-25)28-10-3-4-11-29(28)34)22-32(38)36-18-7-9-27(23-36)33-35-30-12-5-6-13-31(30)37(33)19-8-20-39-2/h3-6,10-17,24,27H,7-9,18-23H2,1-2H3/t24-,27-/m1/s1 |
| InChIKey | QVQYKUCXJQUATB-SHQCIBLASA-N |
| XLogP | 7.37 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.14 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|