C25H40N4O2 — CID 66792694
N-tert-butyl-2-[4-(2-tert-butylphenyl)piperazin-1-yl]-2-oxo-N-piperidin-4-ylacetamide (PubChem CID 66792694) has the molecular formula C25H40N4O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is N-tert-butyl-2-[4-(2-tert-butylphenyl)piperazin-1-yl]-2-oxo-N-piperidin-4-ylacetamide.
| Compound Name | N-tert-butyl-2-[4-(2-tert-butylphenyl)piperazin-1-yl]-2-oxo-N-piperidin-4-ylacetamide |
|---|---|
| PubChem CID | 66792694 |
| Molecular Formula | C25H40N4O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | N-tert-butyl-2-[4-(2-tert-butylphenyl)piperazin-1-yl]-2-oxo-N-piperidin-4-ylacetamide |
| SMILES | CC(C)(C)c1ccccc1N1CCN(C(=O)C(=O)N(C2CCNCC2)C(C)(C)C)CC1 |
| InChI | InChI=1S/C25H40N4O2/c1-24(2,3)20-9-7-8-10-21(20)27-15-17-28(18-16-27)22(30)23(31)29(25(4,5)6)19-11-13-26-14-12-19/h7-10,19,26H,11-18H2,1-6H3 |
| InChIKey | PKKQBXWHJFQGFV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|