C26H36N2O3 — CID 66792713
3-[4-(2-tert-butylphenyl)piperazine-1-carbonyl]adamantane-1-carboxylic acid (PubChem CID 66792713) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is 3-[4-(2-tert-butylphenyl)piperazine-1-carbonyl]adamantane-1-carboxylic acid.
| Compound Name | 3-[4-(2-tert-butylphenyl)piperazine-1-carbonyl]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 66792713 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 3-[4-(2-tert-butylphenyl)piperazine-1-carbonyl]adamantane-1-carboxylic acid |
| SMILES | CC(C)(C)c1ccccc1N1CCN(C(=O)C23CC4CC(CC(C(=O)O)(C4)C2)C3)CC1 |
| InChI | InChI=1S/C26H36N2O3/c1-24(2,3)20-6-4-5-7-21(20)27-8-10-28(11-9-27)22(29)25-13-18-12-19(14-25)16-26(15-18,17-25)23(30)31/h4-7,18-19H,8-17H2,1-3H3,(H,30,31) |
| InChIKey | UFIQNYCAFNWRET-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |