C18H24N2O3 — CID 66793118
ethyl 2-[4-(4-methyl-2-prop-1-en-2-ylphenyl)piperazin-1-yl]-2-oxoacetate (PubChem CID 66793118) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is ethyl 2-[4-(4-methyl-2-prop-1-en-2-ylphenyl)piperazin-1-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[4-(4-methyl-2-prop-1-en-2-ylphenyl)piperazin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 66793118 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | ethyl 2-[4-(4-methyl-2-prop-1-en-2-ylphenyl)piperazin-1-yl]-2-oxoacetate |
| SMILES | C=C(C)c1cc(C)ccc1N1CCN(C(=O)C(=O)OCC)CC1 |
| InChI | InChI=1S/C18H24N2O3/c1-5-23-18(22)17(21)20-10-8-19(9-11-20)16-7-6-14(4)12-15(16)13(2)3/h6-7,12H,2,5,8-11H2,1,3-4H3 |
| InChIKey | ZUGPKFLREBVUCB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|