C26H36N2O2 — CID 66794799
1-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-5-(4-benzylpiperidin-1-yl)pentane-1,5-dione (PubChem CID 66794799) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-5-(4-benzylpiperidin-1-yl)pentane-1,5-dione.
| Compound Name | 1-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-5-(4-benzylpiperidin-1-yl)pentane-1,5-dione |
|---|---|
| PubChem CID | 66794799 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 1-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-5-(4-benzylpiperidin-1-yl)pentane-1,5-dione |
| SMILES | O=C(CCCC(=O)N1CCC2CCCC=C2C1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H36N2O2/c29-25(27-16-13-22(14-17-27)19-21-7-2-1-3-8-21)11-6-12-26(30)28-18-15-23-9-4-5-10-24(23)20-28/h1-3,7-8,10,22-23H,4-6,9,11-20H2 |
| InChIKey | GGCLEGVROHFDCD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|