C14H19NO6 — CID 66795830
[2-(2-acetyloxy-7-oxoazepan-1-yl)-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 66795830) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is [2-(2-acetyloxy-7-oxoazepan-1-yl)-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-(2-acetyloxy-7-oxoazepan-1-yl)-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 66795830 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | [2-(2-acetyloxy-7-oxoazepan-1-yl)-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)N1C(=O)CCCCC1OC(C)=O |
| InChI | InChI=1S/C14H19NO6/c1-9(2)14(19)20-8-12(18)15-11(17)6-4-5-7-13(15)21-10(3)16/h13H,1,4-8H2,2-3H3 |
| InChIKey | IMJMJBCDZIPELN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|